CAS 108082-57-1 appears in our catalog under these names: (S)–2,2–Dimethyl–1–phenylpropan–1–amine hydrochloride, (S)-2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 95%, (S)-2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride (CAS 108082-57-1) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride. InChIKey: BMOFDSTXFQCVDC-HNCPQSOCSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | BMOFDSTXFQCVDC-HNCPQSOCSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)