cas: 2231-66-5 — see every product listed under this CAS number, including other names
2,2-Dimethyl-5-(propan-2-ylidene)-1,3-dioxane-4,6-dione, 98%, 98% (CAS 2231-66-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118OVG-50mg |
| cas | 2231-66-5 |
| size | 50mg |
| availability | 125g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 93.20 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 789.20 Pln | |
| Chemat | 25g | 2469.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,2-dimethyl-5-propan-2-ylidene-1,3-dioxane-4,6-dione (CAS 2231-66-5) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 2,2-dimethyl-5-propan-2-ylidene-1,3-dioxane-4,6-dione. InChIKey: XPGWFAZUEHWZIR-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2,2-dimethyl-5-propan-2-ylidene-1,3-dioxane-4,6-dione |
| InChIKey | XPGWFAZUEHWZIR-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)OC(OC1=O)(C)C)C |
Computed by PubChem (NCBI)