CAS 2231-66-5 appears in our catalog under these names: 2,2-Dimethyl-5-(propan-2-ylidene)-1,3-dioxane-4,6-dione, 98%, 2,2–Dimethyl–5–(propan–2–ylidene)–1,3–dioxane–4,6–dione, 2,2-Dimethyl-5-(propan-2-ylidene)-1,3-dioxane-4,6-dione, 98%, 98%, 2,2-Dimethyl-5-(propan-2-ylidene)-1,3-dioxane-4,6-dione, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 250mg, 1g, 5g, 50mg, 100mg.
2,2-dimethyl-5-propan-2-ylidene-1,3-dioxane-4,6-dione (CAS 2231-66-5) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 2,2-dimethyl-5-propan-2-ylidene-1,3-dioxane-4,6-dione. InChIKey: XPGWFAZUEHWZIR-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2,2-dimethyl-5-propan-2-ylidene-1,3-dioxane-4,6-dione |
| InChIKey | XPGWFAZUEHWZIR-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)OC(OC1=O)(C)C)C |
Computed by PubChem (NCBI)