cas: 15231-78-4 — see every product listed under this CAS number, including other names
2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione, 98% (CAS 15231-78-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A343810-25g |
| cas | 15231-78-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 3624.46 Pln | |
| AmBeed | 10g | 1847.23 Pln | |
| AmBeed | 5g | 1085.56 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS 15231-78-4) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione. InChIKey: NTUAHNQWHPQAMB-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione |
| InChIKey | NTUAHNQWHPQAMB-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)