cas: 5558-66-7 — see every product listed under this CAS number, including other names
2,2-Diphenylpropionic acid 98% (CAS 5558-66-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A426174-500g |
| cas | 5558-66-7 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 14315.56 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 620.69 Pln | |
| Ambeed | 25g | 1093.50 Pln | |
| Ambeed | 100g | 3630.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A426174 |
2,2-diphenylpropanoic acid (CAS 5558-66-7) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2,2-diphenylpropanoic acid. InChIKey: ODELFXJUOVNEFZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2,2-diphenylpropanoic acid |
| InChIKey | ODELFXJUOVNEFZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)