CAS 5558-66-7 appears in our catalog under these names: 2,2-Diphenylpropionic acid, 95%, 2,2–Diphenylpropionic Acid, 2,2-Diphenylpropionic acid, 2,2-Diphenylpropionic Acid, >96.0%(HPLC)(T), 2,2-Diphenylpropionic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 10g, 500g, 100g, 250mg, 2.5g.
2,2-diphenylpropanoic acid (CAS 5558-66-7) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2,2-diphenylpropanoic acid. InChIKey: ODELFXJUOVNEFZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2,2-diphenylpropanoic acid |
| InChIKey | ODELFXJUOVNEFZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)