cas: 5558-67-8 — see every product listed under this CAS number, including other names
2,2-Diphenylpropionitrile, >98.0%(GC) (CAS 5558-67-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2534-5G |
| cas | 5558-67-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 246.19 Pln | |
| TCI | 25g | 1062.46 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,2-diphenylpropanenitrile (CAS 5558-67-8) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 2,2-diphenylpropanenitrile. InChIKey: DPVHBXFSKLKYIQ-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2,2-diphenylpropanenitrile |
| InChIKey | DPVHBXFSKLKYIQ-UHFFFAOYSA-N |
| SMILES | CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)