CAS 13992-26-2 appears in our catalog under these names: 1-Azido-1-deoxy-beta-d-galactopyranoside tetraacetate, 95%, 2,3,4,6–Tetraacetate–β–D–Galactopyranosyl azide, 2,3,4,6-Tetra-O-acetyl-β-D-galactopyranosyl azide, 2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl azide, 97.00%, 1-Azido-1-deoxy-β-D-galactopyranoside tetraacetate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 0,5g, 2g, 5 g.
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate (CAS 13992-26-2) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate. InChIKey: NHNYHKRWHCWHAJ-MBJXGIAVSA-N.
| Molecular formula | C14H19N3O9 |
|---|---|
| Molecular weight | 373.32 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate |
| InChIKey | NHNYHKRWHCWHAJ-MBJXGIAVSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)