CAS 20379-61-7 appears in our catalog under these names: 2,3,4,6-Tetra-O-acetyl-a-D-glucopyranosyl azide, 2,3,4,6-Tetra-O-acetyl-α-D-glucopyranosy, l azide, 500 mg, 2,3,4,6-Tetra-O-acetyl-α-D-glucopyranosy, l azide, 1 g, 2,3,4,6-Tetra-O-acetyl-α-D-glucopyranosy, l azide, 2 g, 2,3,4,6-Tetra-O-acetyl-α-D-glucopyranosy, l azide, 5 g. Offered by: Biosynth, Roth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 1g, 2g, 5g.
(3,4,5-triacetyloxy-6-azidooxan-2-yl)methyl acetate (CAS 20379-61-7) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: (3,4,5-triacetyloxy-6-azidooxan-2-yl)methyl acetate. InChIKey: NHNYHKRWHCWHAJ-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O9 |
|---|---|
| Molecular weight | 373.32 g/mol |
| IUPAC name | (3,4,5-triacetyloxy-6-azidooxan-2-yl)methyl acetate |
| InChIKey | NHNYHKRWHCWHAJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1C(C(C(C(O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)