2,3-Dibromo-1-chloro-5-fluoro-4-methylbenzene, 97%
cas: 1365969-01-2 — see every product listed under this CAS number, including other names
2,3-Dibromo-1-chloro-5-fluoro-4-methylbenzene, 97% (CAS 1365969-01-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A716096-250mg |
| cas | 1365969-01-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 815.38 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 875.27 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 947.60 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 560.24 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,3-dibromo-1-chloro-5-fluoro-4-methylbenzene (CAS 1365969-01-2) is a chemical compound with the molecular formula C7H4Br2ClF and a molecular weight of 302.36 g/mol. IUPAC name: 2,3-dibromo-1-chloro-5-fluoro-4-methylbenzene. InChIKey: QCKYGDLOXCHXTC-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClF |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | 2,3-dibromo-1-chloro-5-fluoro-4-methylbenzene |
| InChIKey | QCKYGDLOXCHXTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Cl)Br)Br |
Computed by PubChem (NCBI)