CAS 1365969-01-2 appears in our catalog under these names: 2,3-Dibromo-1-chloro-5-fluoro-4-methylbenzene, 97%, 97%, 2,3-Dibromo-1-chloro-5-fluoro-4-methylbenzene, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
2,3-dibromo-1-chloro-5-fluoro-4-methylbenzene (CAS 1365969-01-2) is a chemical compound with the molecular formula C7H4Br2ClF and a molecular weight of 302.36 g/mol. IUPAC name: 2,3-dibromo-1-chloro-5-fluoro-4-methylbenzene. InChIKey: QCKYGDLOXCHXTC-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClF |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | 2,3-dibromo-1-chloro-5-fluoro-4-methylbenzene |
| InChIKey | QCKYGDLOXCHXTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Cl)Br)Br |
Computed by PubChem (NCBI)