cas: 2096329-79-0 — see every product listed under this CAS number, including other names
2,3-Dichloro-4-isobutoxyphenylboronic acid, 97% (CAS 2096329-79-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623482-250MG |
| cas | 2096329-79-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 851.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[2,3-dichloro-4-(2-methylpropoxy)phenyl]boronic acid (CAS 2096329-79-0) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: [2,3-dichloro-4-(2-methylpropoxy)phenyl]boronic acid. InChIKey: DPYMREBBALMFOP-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2O3 |
|---|---|
| Molecular weight | 262.92 g/mol |
| IUPAC name | [2,3-dichloro-4-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | DPYMREBBALMFOP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC(C)C)Cl)Cl)(O)O |
Computed by PubChem (NCBI)