cas: 95399-95-4 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-fluorobenzaldehyde, 98%+(GC-MS),RG, 98%+(GC-MS),RG (CAS 95399-95-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJ1X-250mg |
| cas | 95399-95-4 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 942.80 Pln | |
| Chemat | 25g | 3611.60 Pln |
| purity | 98%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2,3-dichloro-6-fluorobenzaldehyde (CAS 95399-95-4) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,3-dichloro-6-fluorobenzaldehyde. InChIKey: BDPIHKOPKWGJCU-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,3-dichloro-6-fluorobenzaldehyde |
| InChIKey | BDPIHKOPKWGJCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C=O)Cl)Cl |
Computed by PubChem (NCBI)