CAS 916420-61-6 appears in our catalog under these names: 3,6-Dichloro-2-fluorobenzaldehyde, 98%, 3,6-Dichloro-2-fluorobenzaldehyde. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 10g, 5g.
3,6-dichloro-2-fluorobenzaldehyde (CAS 916420-61-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 3,6-dichloro-2-fluorobenzaldehyde. InChIKey: ZYBCMWVCTUCCQP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 3,6-dichloro-2-fluorobenzaldehyde |
| InChIKey | ZYBCMWVCTUCCQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C=O)F)Cl |
Computed by PubChem (NCBI)