CAS 394-39-8 appears in our catalog under these names: 4-Chloro-2-fluorobenzoyl chloride, 98%, 4-Chloro-2-fluorobenzoyl chloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g.
4-chloro-2-fluorobenzoyl chloride (CAS 394-39-8) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 4-chloro-2-fluorobenzoyl chloride. InChIKey: PWHFJLCMUCFYRQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 4-chloro-2-fluorobenzoyl chloride |
| InChIKey | PWHFJLCMUCFYRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C(=O)Cl |
Computed by PubChem (NCBI)