CAS 1785621-05-7 appears in our catalog under these names: 2,4-Dichloro-3-fluorobenzaldehyde, 95%, 2,4-Dichloro-3-fluorobenzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
2,4-dichloro-3-fluorobenzaldehyde (CAS 1785621-05-7) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,4-dichloro-3-fluorobenzaldehyde. InChIKey: SABAFIAZCVXLNN-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,4-dichloro-3-fluorobenzaldehyde |
| InChIKey | SABAFIAZCVXLNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Cl)F)Cl |
Computed by PubChem (NCBI)