CAS 21900-51-6 appears in our catalog under these names: 2-Chloro-5-fluorobenzoyl chloride, 95%, 2-Chloro-5-fluorobenzoyl chloride 98%, 2-Chloro-5-fluorobenzoyl chloride. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 25g.
2-chloro-5-fluorobenzoyl chloride (CAS 21900-51-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2-chloro-5-fluorobenzoyl chloride. InChIKey: SGZSJPBASHYOHQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2-chloro-5-fluorobenzoyl chloride |
| InChIKey | SGZSJPBASHYOHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)Cl)Cl |
Computed by PubChem (NCBI)