CAS 79455-63-3 appears in our catalog under these names: 2-Chloro-6-fluorobenzoyl chloride, 98%, 2–chloro–6–fluorobenzoyl chloride, 2-Chloro-6-fluorobenzoyl Chloride, >98.0%(GC)(T), 2-Chloro-6-fluorobenzene-1-carbonyl chloride, 97% , 2-Chloro-6-fluorobenzoyl chloride 98%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g.
2-chloro-6-fluorobenzoyl chloride (CAS 79455-63-3) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2-chloro-6-fluorobenzoyl chloride. InChIKey: GFNAJZAKJGKJCS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2-chloro-6-fluorobenzoyl chloride |
| InChIKey | GFNAJZAKJGKJCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)