cas: 51571-16-5 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-hydroxybenzaldehyde, 98% (CAS 51571-16-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A163692-10g |
| cas | 51571-16-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8148.91 Pln | |
| AmBeed | 25g | 20016.64 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 929.90 Pln | |
| Fluorochem | 5g | 3668.52 Pln | |
| Fluorochem | 10g | 6412.34 Pln | |
| Fluorochem | 25g | 12602.87 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-dichloro-6-hydroxybenzaldehyde (CAS 51571-16-5) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: 2,3-dichloro-6-hydroxybenzaldehyde. InChIKey: MYRBSVRXUYEZPM-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 2,3-dichloro-6-hydroxybenzaldehyde |
| InChIKey | MYRBSVRXUYEZPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)C=O)Cl)Cl |
Computed by PubChem (NCBI)