CAS 40100-98-9 appears in our catalog under these names: 3,5-Dichloro-2-methylcyclohexa-2,5-diene-1,4-dione, 98%, 3,5-Dichloro-2-methyl-benzoquinone, >95% (HPLC), 3,5-Dichloro-2-methyl-benzoquinone. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 500mg, 50mg, 25mg.
3,5-dichloro-2-methylcyclohexa-2,5-diene-1,4-dione (CAS 40100-98-9) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: 3,5-dichloro-2-methylcyclohexa-2,5-diene-1,4-dione. InChIKey: GNBZSYCVGHQSMC-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 3,5-dichloro-2-methylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | GNBZSYCVGHQSMC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C(=CC1=O)Cl)Cl |
Computed by PubChem (NCBI)