CAS 15216-81-6 appears in our catalog under these names: 5-Chloro-2-hydroxybenzoyl chloride, 95%, 5–chloro–2–hydroxybenzoyl chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-chloro-2-hydroxybenzoyl chloride (CAS 15216-81-6) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: 5-chloro-2-hydroxybenzoyl chloride. InChIKey: NANJQJRZYOVMLF-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 5-chloro-2-hydroxybenzoyl chloride |
| InChIKey | NANJQJRZYOVMLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)Cl)O |
Computed by PubChem (NCBI)