CAS 27164-10-9 appears in our catalog under these names: 2,5-Dichloro-4-hydroxybenzaldehyde, 95%, 2,5-Dichloro-4-hydroxybenzaldehyde. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g.
2,5-dichloro-4-hydroxybenzaldehyde (CAS 27164-10-9) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: 2,5-dichloro-4-hydroxybenzaldehyde. InChIKey: BUJHRHRKNMSZAW-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 2,5-dichloro-4-hydroxybenzaldehyde |
| InChIKey | BUJHRHRKNMSZAW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)O)Cl)C=O |
Computed by PubChem (NCBI)