CAS 19358-41-9 appears in our catalog under these names: 2-Chlorophenyl chloroformate, 95%, 2-CHLOROPHENYL CHLOROFORMATE, 97%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 5g, 1g.
(2-chlorophenyl) carbonochloridate (CAS 19358-41-9) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: (2-chlorophenyl) carbonochloridate. InChIKey: PENYBFRQSLVMLW-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | (2-chlorophenyl) carbonochloridate |
| InChIKey | PENYBFRQSLVMLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC(=O)Cl)Cl |
Computed by PubChem (NCBI)