CAS 72736-71-1 is the registry number for 4,6-Dichlorobenzo[d][1,3]dioxole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1,3-benzodioxole (CAS 72736-71-1) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: 4,6-dichloro-1,3-benzodioxole. InChIKey: OCLFGYRJXMSRSN-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 4,6-dichloro-1,3-benzodioxole |
| InChIKey | OCLFGYRJXMSRSN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)