cas: 65078-77-5 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-nitroaniline, 97% (CAS 65078-77-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg, 2.5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QJ-8065-10g |
| cas | 65078-77-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 2.5g | 284.29 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 706.02 Pln | |
| Fluorochem | 25g | 1658.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,3-dichloro-6-nitroaniline (CAS 65078-77-5) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,3-dichloro-6-nitroaniline. InChIKey: RDCOVUDTFKIURA-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,3-dichloro-6-nitroaniline |
| InChIKey | RDCOVUDTFKIURA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)Cl)Cl |
Computed by PubChem (NCBI)