CAS 58484-01-8 appears in our catalog under these names: 3-Amino-2,6-dichloropyridine-4-carboxylic acid, 95%, 3-Amino-2,6-dichloroisonicotinic Acid, 3–Amino–2,6–dichloroisonicotinic acid, 3-Amino-2,6-dichloroisonicotinic acid, 97%, 97%, 3-Amino-2,6-dichloroisonicotinic acid, 97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 2,5g, 100mg, 250mg.
3-amino-2,6-dichloropyridine-4-carboxylic acid (CAS 58484-01-8) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 3-amino-2,6-dichloropyridine-4-carboxylic acid. InChIKey: VKPLOTZPQFRWQP-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3-amino-2,6-dichloropyridine-4-carboxylic acid |
| InChIKey | VKPLOTZPQFRWQP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)N)C(=O)O |
Computed by PubChem (NCBI)