CAS 958804-40-5 appears in our catalog under these names: 3,4-Dichloro-2-nitroaniline, 96%, 3,4-Dichloro-2-nitroaniline. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 500mg.
3,4-dichloro-2-nitroaniline (CAS 958804-40-5) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 3,4-dichloro-2-nitroaniline. InChIKey: GTCVNPULEBIHMP-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3,4-dichloro-2-nitroaniline |
| InChIKey | GTCVNPULEBIHMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)