CAS 17122-17-7 is the registry number for 4-Amino-3,5-dichloropicolinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3,5-dichloropyridine-2-carboxylic acid (CAS 17122-17-7) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 4-amino-3,5-dichloropyridine-2-carboxylic acid. InChIKey: XARSTRKAGOKHMQ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 4-amino-3,5-dichloropyridine-2-carboxylic acid |
| InChIKey | XARSTRKAGOKHMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)C(=O)O)Cl)N)Cl |
Computed by PubChem (NCBI)