Products 17122-17-7

CAS 17122-17-7 is the registry number for 4-Amino-3,5-dichloropicolinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-amino-3,5-dichloropyridine-2-carboxylic acid (CAS 17122-17-7) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 4-amino-3,5-dichloropyridine-2-carboxylic acid. InChIKey: XARSTRKAGOKHMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Cl2N2O2
Molecular weight207.01 g/mol
IUPAC name4-amino-3,5-dichloropyridine-2-carboxylic acid
InChIKeyXARSTRKAGOKHMQ-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=N1)C(=O)O)Cl)N)Cl

Computed by PubChem (NCBI)