CAS 2683-43-4 appears in our catalog under these names: 2,4-Dichloro-6-nitroaniline, 98%, 2,4-Dichloro-6-nitroaniline, 2,4–Dichloro–6–nitroaniline, 2,4-Dichloro-6-nitroaniline 97%, 2,4-Dichloro-6-nitroaniline, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 500mg, 100g, 10g.
2,4-dichloro-6-nitroaniline (CAS 2683-43-4) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,4-dichloro-6-nitroaniline. InChIKey: IZEZAMILKKYOPW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,4-dichloro-6-nitroaniline |
| InChIKey | IZEZAMILKKYOPW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Cl)Cl |
Computed by PubChem (NCBI)