CAS 1073182-87-2 appears in our catalog under these names: 3-Amino-4,6-dichloropicolinic acid, 95%, 3–Amino–4,6–dichloropicolinic acid, 3-Amino-4,6-dichloropicolinic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg.
3-amino-4,6-dichloropyridine-2-carboxylic acid (CAS 1073182-87-2) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 3-amino-4,6-dichloropyridine-2-carboxylic acid. InChIKey: OVJPREKPWUUJQJ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3-amino-4,6-dichloropyridine-2-carboxylic acid |
| InChIKey | OVJPREKPWUUJQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)C(=O)O)N)Cl |
Computed by PubChem (NCBI)