CAS 261761-55-1 is the registry number for 2,3-Dichloro-N'-hydroxybenzenecarboximidamide, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 10g.
2,3-dichloro-N'-hydroxybenzenecarboximidamide (CAS 261761-55-1) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,3-dichloro-N'-hydroxybenzenecarboximidamide. InChIKey: OPOPCNCEDLBYPV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,3-dichloro-N'-hydroxybenzenecarboximidamide |
| InChIKey | OPOPCNCEDLBYPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=NO)N |
Computed by PubChem (NCBI)