CAS 867151-44-8 appears in our catalog under these names: 2,6-Dichlorobenzohydrazide, 95%, 2,6-Dichlorobenzohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,6-dichlorobenzohydrazide (CAS 867151-44-8) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,6-dichlorobenzohydrazide. InChIKey: RZTXCLYVFUMCQM-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,6-dichlorobenzohydrazide |
| InChIKey | RZTXCLYVFUMCQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)NN)Cl |
Computed by PubChem (NCBI)