CAS 329794-24-3 appears in our catalog under these names: 2,3-Dichloro-n-methyl-4-pyridinecarboxamide, 95%, 2,3-Dichloro-N-methylisonicotinamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
2,3-dichloro-N-methylpyridine-4-carboxamide (CAS 329794-24-3) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,3-dichloro-N-methylpyridine-4-carboxamide. InChIKey: NXUXXWJJQITIQB-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,3-dichloro-N-methylpyridine-4-carboxamide |
| InChIKey | NXUXXWJJQITIQB-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C(=NC=C1)Cl)Cl |
Computed by PubChem (NCBI)