CAS 23505-21-7 appears in our catalog under these names: 2,6-Dichloro-n'-hydroxybenzenecarboximidamide, 95%, 2,6-Dichloro-N-hydroxybenzimidamide, 97%, 2,6-Dichloro-N'-hydroxybenzene-1-carboximidamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 0,5g.
2,6-dichloro-N'-hydroxybenzenecarboximidamide (CAS 23505-21-7) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,6-dichloro-N'-hydroxybenzenecarboximidamide. InChIKey: MULRGOOZFNLPFF-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,6-dichloro-N'-hydroxybenzenecarboximidamide |
| InChIKey | MULRGOOZFNLPFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=NO)N)Cl |
Computed by PubChem (NCBI)