Products 67487-35-8
CAS 67487-35-8 appears in our catalog under these names: 2,5-Dichlorobenzhydrazide, 95%, 2,5-Dichlorobenzhydrazide/ 98+%, 2,5-Dichlorobenzhydrazide, 2,5-Dichlorobenzohydrazide 97%, 2,5-Dichlorobenzohydrazide, 97%, 97%. Offered by: Combi-blocks, Chemat, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 50g.
2,5-dichlorobenzohydrazide (CAS 67487-35-8) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,5-dichlorobenzohydrazide. InChIKey: XECBCXNWGBDIMG-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,5-dichlorobenzohydrazide |
| InChIKey | XECBCXNWGBDIMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NN)Cl |
Computed by PubChem (NCBI)