CAS 38841-54-2 appears in our catalog under these names: 2,6-Dichloro-4-methylnicotinamide, 96%, 2,6-Dichloro-4-methylnicotinamide, 97%, 97%, 2,6-Dichloro-4-methylnicotinamide, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 250mg.
2,6-dichloro-4-methylpyridine-3-carboxamide (CAS 38841-54-2) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,6-dichloro-4-methylpyridine-3-carboxamide. InChIKey: FUHRWOFCZTZGQA-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,6-dichloro-4-methylpyridine-3-carboxamide |
| InChIKey | FUHRWOFCZTZGQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)