Products 82417-45-6

CAS 82417-45-6 appears in our catalog under these names: 2,3–Dichlorobenzenesulfonyl chloride, 2,3-Dichlorobenzenesulfonyl chloride/ 98%, 2,3-Dichlorobenzenesulfonyl chloride, 98% , 2,3-Dichlorobenzenesulfonyl Chloride, >96.0%(GC)(T), 2,3-Dichlorobenzenesulfonyl chloride, 97%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2,3-dichlorobenzenesulfonyl chloride (CAS 82417-45-6) is a chemical compound with the molecular formula C6H3Cl3O2S and a molecular weight of 245.5 g/mol. IUPAC name: 2,3-dichlorobenzenesulfonyl chloride. InChIKey: PQODWTNHDKDHIW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl3O2S
Molecular weight245.5 g/mol
IUPAC name2,3-dichlorobenzenesulfonyl chloride
InChIKeyPQODWTNHDKDHIW-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)