cas: 958027-82-2 — see every product listed under this CAS number, including other names
2,3-Dichlorophenethyl bromide 95% (CAS 958027-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A699839-250mg |
| cas | 958027-82-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1482.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A699839 |
1-(2-bromoethyl)-2,3-dichlorobenzene (CAS 958027-82-2) is a chemical compound with the molecular formula C8H7BrCl2 and a molecular weight of 253.95 g/mol. IUPAC name: 1-(2-bromoethyl)-2,3-dichlorobenzene. InChIKey: FDYYGZOWHGEICH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2 |
|---|---|
| Molecular weight | 253.95 g/mol |
| IUPAC name | 1-(2-bromoethyl)-2,3-dichlorobenzene |
| InChIKey | FDYYGZOWHGEICH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CCBr |
Computed by PubChem (NCBI)