cas: 10236-60-9 — see every product listed under this CAS number, including other names
2,3-Dichlorophenylacetic acid (CAS 10236-60-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033771-1G |
| cas | 10236-60-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 331.15 Pln | |
| Fluorochem | 100g | 919.49 Pln |
| delivery time | 3-4 weeks |
|---|
2-(2,3-dichlorophenyl)acetic acid (CAS 10236-60-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)acetic acid. InChIKey: YWMXEUIQZOQESD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)acetic acid |
| InChIKey | YWMXEUIQZOQESD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)