cas: 2586126-70-5 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-(methoxymethoxy)benzaldehyde (CAS 2586126-70-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628564-1G |
| cas | 2586126-70-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3720.58 Pln | |
| Fluorochem | 5g | 11025.30 Pln |
| delivery time | 3-4 weeks |
|---|
2,3-difluoro-4-(methoxymethoxy)benzaldehyde (CAS 2586126-70-5) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,3-difluoro-4-(methoxymethoxy)benzaldehyde. InChIKey: UNGFTVUDLRYKDT-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2,3-difluoro-4-(methoxymethoxy)benzaldehyde |
| InChIKey | UNGFTVUDLRYKDT-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)C=O)F)F |
Computed by PubChem (NCBI)