2,3-Difluoro-6-hydroxybenzoic acid, 95%
cas: 749230-47-5 — see every product listed under this CAS number, including other names
2,3-Difluoro-6-hydroxybenzoic acid, 95% (CAS 749230-47-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A392577-250mg |
| cas | 749230-47-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 2578.69 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 647.57 Pln | |
| BLDpharm | 5g | 1891.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,3-difluoro-6-hydroxybenzoic acid (CAS 749230-47-5) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-6-hydroxybenzoic acid. InChIKey: XQQZVFHVBKZXBK-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,3-difluoro-6-hydroxybenzoic acid |
| InChIKey | XQQZVFHVBKZXBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)C(=O)O)F)F |
Computed by PubChem (NCBI)