Products 749230-47-5

CAS 749230-47-5 appears in our catalog under these names: 5,6–Difluorosalicylic Acid, 2,3-Difluoro-6-hydroxybenzoic acid 95%, 2,3-Difluoro-6-hydroxybenzoic acid, 95%, 95%, 2,3-Difluoro-6-hydroxybenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

2,3-difluoro-6-hydroxybenzoic acid (CAS 749230-47-5) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-6-hydroxybenzoic acid. InChIKey: XQQZVFHVBKZXBK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4F2O3
Molecular weight174.10 g/mol
IUPAC name2,3-difluoro-6-hydroxybenzoic acid
InChIKeyXQQZVFHVBKZXBK-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1O)C(=O)O)F)F

Computed by PubChem (NCBI)