2,3-Difluoro-6-nitroaniline, 95%
cas: 211693-73-1 — see every product listed under this CAS number, including other names
2,3-Difluoro-6-nitroaniline, 95% (CAS 211693-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008168-1G |
| cas | 211693-73-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 143.72 Pln | |
| Fluorochem | 100g | 409.25 Pln | |
| Fluorochem | 500g | 1815.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,3-difluoro-6-nitroaniline (CAS 211693-73-1) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-6-nitroaniline. InChIKey: DIPGYZSCGXBTEU-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,3-difluoro-6-nitroaniline |
| InChIKey | DIPGYZSCGXBTEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)F)F |
Computed by PubChem (NCBI)