CAS 1443287-46-4 is the registry number for 3-(Difluoromethyl)pyrazine-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-(difluoromethyl)pyrazine-2-carboxylic acid (CAS 1443287-46-4) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 3-(difluoromethyl)pyrazine-2-carboxylic acid. InChIKey: SGYVAKLKRGJAOT-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 3-(difluoromethyl)pyrazine-2-carboxylic acid |
| InChIKey | SGYVAKLKRGJAOT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(F)F)C(=O)O |
Computed by PubChem (NCBI)