Products 1443287-46-4

CAS 1443287-46-4 is the registry number for 3-(Difluoromethyl)pyrazine-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.

3-(difluoromethyl)pyrazine-2-carboxylic acid (CAS 1443287-46-4) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 3-(difluoromethyl)pyrazine-2-carboxylic acid. InChIKey: SGYVAKLKRGJAOT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F2N2O2
Molecular weight174.10 g/mol
IUPAC name3-(difluoromethyl)pyrazine-2-carboxylic acid
InChIKeySGYVAKLKRGJAOT-UHFFFAOYSA-N
SMILESC1=CN=C(C(=N1)C(F)F)C(=O)O

Computed by PubChem (NCBI)