CAS 1803824-12-5 is the registry number for 2,3-Difluoro-5-nitroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-difluoro-5-nitroaniline (CAS 1803824-12-5) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-5-nitroaniline. InChIKey: ONYLPOSIBFCBLV-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,3-difluoro-5-nitroaniline |
| InChIKey | ONYLPOSIBFCBLV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)