cas: 116-66-5 — see every product listed under this CAS number, including other names
2,3-Dihydro-1,1,3,3,5-Pentamethyl-4,6-Dinitro-1H-Indene, 98%, 98% (CAS 116-66-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BCG-100mg |
| cas | 116-66-5 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 500mg | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,1,3,3,5-pentamethyl-4,6-dinitro-2H-indene (CAS 116-66-5) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1,1,3,3,5-pentamethyl-4,6-dinitro-2H-indene. InChIKey: UHWURQRPEIFIAK-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1,1,3,3,5-pentamethyl-4,6-dinitro-2H-indene |
| InChIKey | UHWURQRPEIFIAK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1[N+](=O)[O-])C(CC2(C)C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)