CAS 116-66-5 appears in our catalog under these names: 1,1,3,3,5-Pentamethyl-4,6-dinitroindane, 98%, Musk moskene (technical), Musk moskene (technical) 10 µg/mL in Cyclohexane, 2,3-Dihydro-1,1,3,3,5-Pentamethyl-4,6-Dinitro-1H-Indene, 98%, 98%, Musk moskene, Concentration: 100 µg/ml Solvent: Cyclohexane. Offered by: Combi-blocks, Dr. Ehrenstorfer, Chemat, HPC Standards. Available pack sizes: 1g, 5g, 250mg, 100mg, 1ml, 500mg, 1x5ml.
1,1,3,3,5-pentamethyl-4,6-dinitro-2H-indene (CAS 116-66-5) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1,1,3,3,5-pentamethyl-4,6-dinitro-2H-indene. InChIKey: UHWURQRPEIFIAK-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1,1,3,3,5-pentamethyl-4,6-dinitro-2H-indene |
| InChIKey | UHWURQRPEIFIAK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1[N+](=O)[O-])C(CC2(C)C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)