cas: 1083168-92-6 — see every product listed under this CAS number, including other names
2,3-Dimethoxypyridine-5-boronic acid pinacol ester, 95% (CAS 1083168-92-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236698-10MG |
| cas | 1083168-92-6 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10mg | 331.15 Pln | |
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 1g | 1684.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,3-dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1083168-92-6) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: 2,3-dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: CJHRJDZURRUHSH-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 2,3-dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | CJHRJDZURRUHSH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OC)OC |
Computed by PubChem (NCBI)