CAS 25128-35-2 appears in our catalog under these names: 2,3-Dioxoindoline-7-carboxylic acid, 97% , 2,3-Dioxoindoline-7-carboxylic acid 96%, 2,3-Dioxoindoline-7-carboxylic Acid, 96%, 96%, 2,3-Dioxoindoline-7-carboxylic acid, 95%. Offered by: Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 250mg, 5g, 25g, 50g, 100g.
2,3-dioxo-1H-indole-7-carboxylic acid (CAS 25128-35-2) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 2,3-dioxo-1H-indole-7-carboxylic acid. InChIKey: ROODQCZSWXEDJL-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 2,3-dioxo-1H-indole-7-carboxylic acid |
| InChIKey | ROODQCZSWXEDJL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NC(=O)C2=O |
Computed by PubChem (NCBI)