Products 41704-95-4

Name: 2,3-Dioxoindoline-4-carboxylic acid, 95%
Availability: InStock

CAS 41704-95-4 is the registry number for 2,3-Dioxoindoline-4-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.

2,3-Dioxoindoline-4-carboxylic acid, 95%

Combi-blocks, Ambeed, BLDpharm

size: 1g, 100mg, 5g, 250mg
Variants: 15

from 1160.25

View product

2,3-dioxo-1H-indole-4-carboxylic acid (CAS 41704-95-4) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 2,3-dioxo-1H-indole-4-carboxylic acid. InChIKey: ZTBVJLXMEWWFHD-UHFFFAOYSA-N.

Identity
Molecular formula	C₉H₅NO₄
Molecular weight	191.14 g/mol
IUPAC name	2,3-dioxo-1H-indole-4-carboxylic acid
InChIKey	ZTBVJLXMEWWFHD-UHFFFAOYSA-N
SMILES	C1=CC(=C2C(=C1)NC(=O)C2=O)C(=O)O

Computed by PubChem (NCBI)

Synonyms: 2,3-Dioxoindoline-4-carboxylic acid, 2,3-dioxo-1H-indole-4-carboxylic acid, 2,3-Dioxo-2,3-dihydro-1H-indole-4-carboxylic acid, 1H-Indole-4-carboxylic acid, 2,3-dihydro-2,3-dioxo-, 2,3-Dioxoindoline-4-carboxylicacid

Products 41704-95-4

2,3-Dioxoindoline-4-carboxylic acid, 95%

Isomers (same molecular formula)