Products 41704-95-4
CAS 41704-95-4 appears in our catalog under these names: 2,3-Dioxoindoline-4-carboxylic acid, 95%, 95%, 2,3-Dioxoindoline-4-carboxylic acid, 95%, 2,3-Dioxoindoline-4-carboxylic acid 95%. Offered by: Chemat, Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3-dioxo-1H-indole-4-carboxylic acid (CAS 41704-95-4) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 2,3-dioxo-1H-indole-4-carboxylic acid. InChIKey: ZTBVJLXMEWWFHD-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 2,3-dioxo-1H-indole-4-carboxylic acid |
| InChIKey | ZTBVJLXMEWWFHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=O)C2=O)C(=O)O |
Computed by PubChem (NCBI)